C74H64 — CID 159646654
1-[3-(3,5-dimethylphenyl)phenyl]-3,5-diphenylbenzene;1,2,5-trimethyl-3-[3-[3-phenyl-5-[3-(2,3,5-trimethylphenyl)phenyl]phenyl]phenyl]benzene (PubChem CID 159646654) has the molecular formula C74H64 and a molecular weight of 953.33 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylphenyl)phenyl]-3,5-diphenylbenzene;1,2,5-trimethyl-3-[3-[3-phenyl-5-[3-(2,3,5-trimethylphenyl)phenyl]phenyl]phenyl]benzene.
| Compound Name | 1-[3-(3,5-dimethylphenyl)phenyl]-3,5-diphenylbenzene;1,2,5-trimethyl-3-[3-[3-phenyl-5-[3-(2,3,5-trimethylphenyl)phenyl]phenyl]phenyl]benzene |
|---|---|
| PubChem CID | 159646654 |
| Molecular Formula | C74H64 |
| Molecular Weight | 953.33 g/mol |
| Exact Mass | 952.50 |
| IUPAC Name | 1-[3-(3,5-dimethylphenyl)phenyl]-3,5-diphenylbenzene;1,2,5-trimethyl-3-[3-[3-phenyl-5-[3-(2,3,5-trimethylphenyl)phenyl]phenyl]phenyl]benzene |
| SMILES | Cc1cc(C)c(C)c(-c2cccc(-c3cc(-c4ccccc4)cc(-c4cccc(-c5cc(C)cc(C)c5C)c4)c3)c2)c1.Cc1cc(C)cc(-c2cccc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)c2)c1 |
| InChI | InChI=1S/C42H38.C32H26/c1-27-18-29(3)31(5)41(20-27)36-16-10-14-34(22-36)39-24-38(33-12-8-7-9-13-33)25-40(26-39)35-15-11-17-37(23-35)42-21-28(2)19-30(4)32(42)6;1-23-16-24(2)18-29(17-23)27-14-9-15-28(19-27)32-21-30(25-10-5-3-6-11-25)20-31(22-32)26-12-7-4-8-13-26/h7-26H,1-6H3;3-22H,1-2H3 |
| InChIKey | MRATZYCTOHKUBZ-UHFFFAOYSA-N |
| XLogP | 20.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 953.33 |
| LogP ≤ 5 | 20.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |