C42H39ClSi — CID 88962543
chloro-tris(2,5-dimethyl-3-phenylphenyl)silane (PubChem CID 88962543) has the molecular formula C42H39ClSi and a molecular weight of 607.31 g/mol. Its IUPAC name is chloro-tris(2,5-dimethyl-3-phenylphenyl)silane.
| Compound Name | chloro-tris(2,5-dimethyl-3-phenylphenyl)silane |
|---|---|
| PubChem CID | 88962543 |
| Molecular Formula | C42H39ClSi |
| Molecular Weight | 607.31 g/mol |
| Exact Mass | 606.25 |
| IUPAC Name | chloro-tris(2,5-dimethyl-3-phenylphenyl)silane |
| SMILES | Cc1cc(-c2ccccc2)c(C)c([Si](Cl)(c2cc(C)cc(-c3ccccc3)c2C)c2cc(C)cc(-c3ccccc3)c2C)c1 |
| InChI | InChI=1S/C42H39ClSi/c1-28-22-37(34-16-10-7-11-17-34)31(4)40(25-28)44(43,41-26-29(2)23-38(32(41)5)35-18-12-8-13-19-35)42-27-30(3)24-39(33(42)6)36-20-14-9-15-21-36/h7-27H,1-6H3 |
| InChIKey | HZIOTQAGTMKYIA-UHFFFAOYSA-N |
| XLogP | 9.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.31 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|