C57H45ClSi — CID 88962531
chloro-tris(3-methyl-2,4-diphenylphenyl)silane (PubChem CID 88962531) has the molecular formula C57H45ClSi and a molecular weight of 793.53 g/mol. Its IUPAC name is chloro-tris(3-methyl-2,4-diphenylphenyl)silane.
| Compound Name | chloro-tris(3-methyl-2,4-diphenylphenyl)silane |
|---|---|
| PubChem CID | 88962531 |
| Molecular Formula | C57H45ClSi |
| Molecular Weight | 793.53 g/mol |
| Exact Mass | 792.30 |
| IUPAC Name | chloro-tris(3-methyl-2,4-diphenylphenyl)silane |
| SMILES | Cc1c(-c2ccccc2)ccc([Si](Cl)(c2ccc(-c3ccccc3)c(C)c2-c2ccccc2)c2ccc(-c3ccccc3)c(C)c2-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C57H45ClSi/c1-40-49(43-22-10-4-11-23-43)34-37-52(55(40)46-28-16-7-17-29-46)59(58,53-38-35-50(44-24-12-5-13-25-44)41(2)56(53)47-30-18-8-19-31-47)54-39-36-51(45-26-14-6-15-27-45)42(3)57(54)48-32-20-9-21-33-48/h4-39H,1-3H3 |
| InChIKey | PTOVZQCWJQJQGD-UHFFFAOYSA-N |
| XLogP | 13.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.53 |
| LogP ≤ 5 | 13.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|