About 1-fluoro-2-methyl-3,4-diphenylbenzene
1-fluoro-2-methyl-3,4-diphenylbenzene (PubChem CID 90266529) has the molecular formula C19H15F
and a molecular weight of 262.33 g/mol. Its IUPAC name is 1-fluoro-2-methyl-3,4-diphenylbenzene.
Molecular Properties
| Compound Name | 1-fluoro-2-methyl-3,4-diphenylbenzene |
| PubChem CID | 90266529 |
| Molecular Formula | C19H15F |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 1-fluoro-2-methyl-3,4-diphenylbenzene |
| SMILES | Cc1c(F)ccc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C19H15F/c1-14-18(20)13-12-17(15-8-4-2-5-9-15)19(14)16-10-6-3-7-11-16/h2-13H,1H3 |
| InChIKey | ZTPNRLHWERNVSU-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-fluoro-2-methyl-3,4-diphenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-2-methyl-3,4-diphenylbenzene?
The IUPAC name of 1-fluoro-2-methyl-3,4-diphenylbenzene (CID 90266529) is 1-fluoro-2-methyl-3,4-diphenylbenzene.
What is the SMILES notation for 1-fluoro-2-methyl-3,4-diphenylbenzene?
The canonical SMILES for 1-fluoro-2-methyl-3,4-diphenylbenzene is Cc1c(F)ccc(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of 1-fluoro-2-methyl-3,4-diphenylbenzene?
The InChIKey is ZTPNRLHWERNVSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15F/c1-14-18(20)13-12-17(15-8-4-2-5-9-15)19(14)16-10-6-3-7-11-16/h2-13H,1H3.
What are the key properties of 1-fluoro-2-methyl-3,4-diphenylbenzene?
1-fluoro-2-methyl-3,4-diphenylbenzene has a molecular weight of 262.33 g/mol, XLogP of 5.47, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-2-methyl-3,4-diphenylbenzene is sourced from PubChem (CID 90266529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).