2-methyl-3,4-diphenylbenzoic acid

C20H16O2 — CID 118554966

IUPAC2-methyl-3,4-diphenylbenzoic acid
SMILESCc1c(C(=O)O)ccc(-c2ccccc2)c1-c1ccccc1
InChIInChI=1S/C20H16O2/c1-14-17(20(21)22)12-13-18(15-8-4-2-5-9-15)19(14)16-10-6-3-7-11-16/h2-13H,1H3,(H,21,22)
InChIKeyYZTJHRBSOITNFD-UHFFFAOYSA-N
MW288.35 g/mol
LogP5.03
Rot. Bonds3

About 2-methyl-3,4-diphenylbenzoic acid

2-methyl-3,4-diphenylbenzoic acid (PubChem CID 118554966) has the molecular formula C20H16O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-methyl-3,4-diphenylbenzoic acid.

Molecular Properties

Compound Name2-methyl-3,4-diphenylbenzoic acid
PubChem CID118554966
Molecular FormulaC20H16O2
Molecular Weight288.35 g/mol
Exact Mass288.12
IUPAC Name2-methyl-3,4-diphenylbenzoic acid
SMILESCc1c(C(=O)O)ccc(-c2ccccc2)c1-c1ccccc1
InChIInChI=1S/C20H16O2/c1-14-17(20(21)22)12-13-18(15-8-4-2-5-9-15)19(14)16-10-6-3-7-11-16/h2-13H,1H3,(H,21,22)
InChIKeyYZTJHRBSOITNFD-UHFFFAOYSA-N
XLogP5.03
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms22
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500288.35
LogP ≤ 55.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-methyl-3,4-diphenylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-3,4-diphenylbenzoic acid?
The IUPAC name of 2-methyl-3,4-diphenylbenzoic acid (CID 118554966) is 2-methyl-3,4-diphenylbenzoic acid.
What is the SMILES notation for 2-methyl-3,4-diphenylbenzoic acid?
The canonical SMILES for 2-methyl-3,4-diphenylbenzoic acid is Cc1c(C(=O)O)ccc(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of 2-methyl-3,4-diphenylbenzoic acid?
The InChIKey is YZTJHRBSOITNFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16O2/c1-14-17(20(21)22)12-13-18(15-8-4-2-5-9-15)19(14)16-10-6-3-7-11-16/h2-13H,1H3,(H,21,22).
What are the key properties of 2-methyl-3,4-diphenylbenzoic acid?
2-methyl-3,4-diphenylbenzoic acid has a molecular weight of 288.35 g/mol, XLogP of 5.03, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3,4-diphenylbenzoic acid is sourced from PubChem (CID 118554966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).