C18H18O5 — CID 157214158
2-methyl-4-phenylbenzene-1,3-dicarboxylic acid;propan-2-one (PubChem CID 157214158) has the molecular formula C18H18O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is 2-methyl-4-phenylbenzene-1,3-dicarboxylic acid;propan-2-one.
| Compound Name | 2-methyl-4-phenylbenzene-1,3-dicarboxylic acid;propan-2-one |
|---|---|
| PubChem CID | 157214158 |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2-methyl-4-phenylbenzene-1,3-dicarboxylic acid;propan-2-one |
| SMILES | CC(C)=O.Cc1c(C(=O)O)ccc(-c2ccccc2)c1C(=O)O |
| InChI | InChI=1S/C15H12O4.C3H6O/c1-9-11(14(16)17)7-8-12(13(9)15(18)19)10-5-3-2-4-6-10;1-3(2)4/h2-8H,1H3,(H,16,17)(H,18,19);1-2H3 |
| InChIKey | ASFKLLVXRUNTJY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |