C18H14N2O3S — CID 91062779
2-methyl-4-phenyl-3-(1,3-thiazol-2-ylcarbamoyl)benzoic acid (PubChem CID 91062779) has the molecular formula C18H14N2O3S and a molecular weight of 338.39 g/mol. Its IUPAC name is 2-methyl-4-phenyl-3-(1,3-thiazol-2-ylcarbamoyl)benzoic acid.
| Compound Name | 2-methyl-4-phenyl-3-(1,3-thiazol-2-ylcarbamoyl)benzoic acid |
|---|---|
| PubChem CID | 91062779 |
| Molecular Formula | C18H14N2O3S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 2-methyl-4-phenyl-3-(1,3-thiazol-2-ylcarbamoyl)benzoic acid |
| SMILES | Cc1c(C(=O)O)ccc(-c2ccccc2)c1C(=O)Nc1nccs1 |
| InChI | InChI=1S/C18H14N2O3S/c1-11-13(17(22)23)7-8-14(12-5-3-2-4-6-12)15(11)16(21)20-18-19-9-10-24-18/h2-10H,1H3,(H,22,23)(H,19,20,21) |
| InChIKey | XZVPZACSOXVREC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |