C9H9N3OS — CID 2999793
1-methyl-N-(1,3-thiazol-2-yl)pyrrole-2-carboxamide (PubChem CID 2999793) has the molecular formula C9H9N3OS and a molecular weight of 207.26 g/mol. Its IUPAC name is 1-methyl-N-(1,3-thiazol-2-yl)pyrrole-2-carboxamide.
| Compound Name | 1-methyl-N-(1,3-thiazol-2-yl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 2999793 |
| Molecular Formula | C9H9N3OS |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 1-methyl-N-(1,3-thiazol-2-yl)pyrrole-2-carboxamide |
| SMILES | Cn1cccc1C(=O)Nc1nccs1 |
| InChI | InChI=1S/C9H9N3OS/c1-12-5-2-3-7(12)8(13)11-9-10-4-6-14-9/h2-6H,1H3,(H,10,11,13) |
| InChIKey | SIIKLFGSKIKXSB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |