C14H17N3O2S — CID 22320712
2-[tert-butyl(hydroxy)amino]-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 22320712) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is 2-[tert-butyl(hydroxy)amino]-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 2-[tert-butyl(hydroxy)amino]-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 22320712 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 2-[tert-butyl(hydroxy)amino]-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | CC(C)(C)N(O)c1ccccc1C(=O)Nc1nccs1 |
| InChI | InChI=1S/C14H17N3O2S/c1-14(2,3)17(19)11-7-5-4-6-10(11)12(18)16-13-15-8-9-20-13/h4-9,19H,1-3H3,(H,15,16,18) |
| InChIKey | JTODWFAWPCPLTF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|