C10H7N3O4S — CID 90933824
[2-(1,3-thiazol-2-ylcarbamoyl)phenyl] nitrate (PubChem CID 90933824) has the molecular formula C10H7N3O4S and a molecular weight of 265.25 g/mol. Its IUPAC name is [2-(1,3-thiazol-2-ylcarbamoyl)phenyl] nitrate.
| Compound Name | [2-(1,3-thiazol-2-ylcarbamoyl)phenyl] nitrate |
|---|---|
| PubChem CID | 90933824 |
| Molecular Formula | C10H7N3O4S |
| Molecular Weight | 265.25 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | [2-(1,3-thiazol-2-ylcarbamoyl)phenyl] nitrate |
| SMILES | O=C(Nc1nccs1)c1ccccc1O[N+](=O)[O-] |
| InChI | InChI=1S/C10H7N3O4S/c14-9(12-10-11-5-6-18-10)7-3-1-2-4-8(7)17-13(15)16/h1-6H,(H,11,12,14) |
| InChIKey | AMFPASOCFBEDRD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|