C18H14N4O4S — CID 17361103
4-methyl-3-nitro-N-[2-(1,3-thiazol-2-ylcarbamoyl)phenyl]benzamide (PubChem CID 17361103) has the molecular formula C18H14N4O4S and a molecular weight of 382.40 g/mol. Its IUPAC name is 4-methyl-3-nitro-N-[2-(1,3-thiazol-2-ylcarbamoyl)phenyl]benzamide.
| Compound Name | 4-methyl-3-nitro-N-[2-(1,3-thiazol-2-ylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 17361103 |
| Molecular Formula | C18H14N4O4S |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 4-methyl-3-nitro-N-[2-(1,3-thiazol-2-ylcarbamoyl)phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccccc2C(=O)Nc2nccs2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H14N4O4S/c1-11-6-7-12(10-15(11)22(25)26)16(23)20-14-5-3-2-4-13(14)17(24)21-18-19-8-9-27-18/h2-10H,1H3,(H,20,23)(H,19,21,24) |
| InChIKey | AJOBUZRFZNCZMV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|