C18H13Cl2N3O3S — CID 17361254
3,5-dichloro-4-methoxy-N-[2-(1,3-thiazol-2-ylcarbamoyl)phenyl]benzamide (PubChem CID 17361254) has the molecular formula C18H13Cl2N3O3S and a molecular weight of 422.29 g/mol. Its IUPAC name is 3,5-dichloro-4-methoxy-N-[2-(1,3-thiazol-2-ylcarbamoyl)phenyl]benzamide.
| Compound Name | 3,5-dichloro-4-methoxy-N-[2-(1,3-thiazol-2-ylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 17361254 |
| Molecular Formula | C18H13Cl2N3O3S |
| Molecular Weight | 422.29 g/mol |
| Exact Mass | 421.01 |
| IUPAC Name | 3,5-dichloro-4-methoxy-N-[2-(1,3-thiazol-2-ylcarbamoyl)phenyl]benzamide |
| SMILES | COc1c(Cl)cc(C(=O)Nc2ccccc2C(=O)Nc2nccs2)cc1Cl |
| InChI | InChI=1S/C18H13Cl2N3O3S/c1-26-15-12(19)8-10(9-13(15)20)16(24)22-14-5-3-2-4-11(14)17(25)23-18-21-6-7-27-18/h2-9H,1H3,(H,22,24)(H,21,23,25) |
| InChIKey | NEKMVTMRPQCQIE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.29 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |