C13H13N3O4S — CID 86046963
4-nitro-2-propoxy-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 86046963) has the molecular formula C13H13N3O4S and a molecular weight of 307.33 g/mol. Its IUPAC name is 4-nitro-2-propoxy-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-nitro-2-propoxy-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 86046963 |
| Molecular Formula | C13H13N3O4S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 4-nitro-2-propoxy-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | CCCOc1cc([N+](=O)[O-])ccc1C(=O)Nc1nccs1 |
| InChI | InChI=1S/C13H13N3O4S/c1-2-6-20-11-8-9(16(18)19)3-4-10(11)12(17)15-13-14-5-7-21-13/h3-5,7-8H,2,6H2,1H3,(H,14,15,17) |
| InChIKey | YFPXFPBMTZIHON-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|