C22H31N3O3S — CID 11395966
2-propoxy-N-(1,3-thiazol-2-yl)-4-(3,5,5-trimethylhexanoylamino)benzamide (PubChem CID 11395966) has the molecular formula C22H31N3O3S and a molecular weight of 417.58 g/mol. Its IUPAC name is 2-propoxy-N-(1,3-thiazol-2-yl)-4-(3,5,5-trimethylhexanoylamino)benzamide.
| Compound Name | 2-propoxy-N-(1,3-thiazol-2-yl)-4-(3,5,5-trimethylhexanoylamino)benzamide |
|---|---|
| PubChem CID | 11395966 |
| Molecular Formula | C22H31N3O3S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 2-propoxy-N-(1,3-thiazol-2-yl)-4-(3,5,5-trimethylhexanoylamino)benzamide |
| SMILES | CCCOc1cc(NC(=O)CC(C)CC(C)(C)C)ccc1C(=O)Nc1nccs1 |
| InChI | InChI=1S/C22H31N3O3S/c1-6-10-28-18-13-16(24-19(26)12-15(2)14-22(3,4)5)7-8-17(18)20(27)25-21-23-9-11-29-21/h7-9,11,13,15H,6,10,12,14H2,1-5H3,(H,24,26)(H,23,25,27) |
| InChIKey | MCJRQXXHSZNSFU-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |