C17H14BN3O4S — CID 87176257
[2-(2-carbamoylphenyl)-3-(1,3-thiazol-2-ylcarbamoyl)phenyl]boronic acid (PubChem CID 87176257) has the molecular formula C17H14BN3O4S and a molecular weight of 367.20 g/mol. Its IUPAC name is [2-(2-carbamoylphenyl)-3-(1,3-thiazol-2-ylcarbamoyl)phenyl]boronic acid.
| Compound Name | [2-(2-carbamoylphenyl)-3-(1,3-thiazol-2-ylcarbamoyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 87176257 |
| Molecular Formula | C17H14BN3O4S |
| Molecular Weight | 367.20 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | [2-(2-carbamoylphenyl)-3-(1,3-thiazol-2-ylcarbamoyl)phenyl]boronic acid |
| SMILES | NC(=O)c1ccccc1-c1c(B(O)O)cccc1C(=O)Nc1nccs1 |
| InChI | InChI=1S/C17H14BN3O4S/c19-15(22)11-5-2-1-4-10(11)14-12(6-3-7-13(14)18(24)25)16(23)21-17-20-8-9-26-17/h1-9,24-25H,(H2,19,22)(H,20,21,23) |
| InChIKey | FOWOXYNDZRONRJ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.20 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|