C12H13N7OS — CID 168602042
2-[[amino-(diaminomethylideneamino)methylidene]amino]-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 168602042) has the molecular formula C12H13N7OS and a molecular weight of 303.35 g/mol. Its IUPAC name is 2-[[amino-(diaminomethylideneamino)methylidene]amino]-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 2-[[amino-(diaminomethylideneamino)methylidene]amino]-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 168602042 |
| Molecular Formula | C12H13N7OS |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2-[[amino-(diaminomethylideneamino)methylidene]amino]-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | NC(N)=N/C(N)=N/c1ccccc1C(=O)Nc1nccs1 |
| InChI | InChI=1S/C12H13N7OS/c13-10(14)19-11(15)17-8-4-2-1-3-7(8)9(20)18-12-16-5-6-21-12/h1-6H,(H,16,18,20)(H6,13,14,15,17,19) |
| InChIKey | OIUXTGSCNVOWPK-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 144.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|