About 6-hydrazinyl-N-(1,3-thiazol-2-yl)pyridazine-3-carboxamide
6-hydrazinyl-N-(1,3-thiazol-2-yl)pyridazine-3-carboxamide (PubChem CID 62237920) has the molecular formula C8H8N6OS
and a molecular weight of 236.26 g/mol. Its IUPAC name is 6-hydrazinyl-N-(1,3-thiazol-2-yl)pyridazine-3-carboxamide.
Molecular Properties
| Compound Name | 6-hydrazinyl-N-(1,3-thiazol-2-yl)pyridazine-3-carboxamide |
| PubChem CID | 62237920 |
| Molecular Formula | C8H8N6OS |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 6-hydrazinyl-N-(1,3-thiazol-2-yl)pyridazine-3-carboxamide |
| SMILES | NNc1ccc(C(=O)Nc2nccs2)nn1 |
| InChI | InChI=1S/C8H8N6OS/c9-12-6-2-1-5(13-14-6)7(15)11-8-10-3-4-16-8/h1-4H,9H2,(H,12,14)(H,10,11,15) |
| InChIKey | HJHLWNXOFLPIBA-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-hydrazinyl-N-(1,3-thiazol-2-yl)pyridazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydrazinyl-N-(1,3-thiazol-2-yl)pyridazine-3-carboxamide?
The IUPAC name of 6-hydrazinyl-N-(1,3-thiazol-2-yl)pyridazine-3-carboxamide (CID 62237920) is 6-hydrazinyl-N-(1,3-thiazol-2-yl)pyridazine-3-carboxamide.
What is the SMILES notation for 6-hydrazinyl-N-(1,3-thiazol-2-yl)pyridazine-3-carboxamide?
The canonical SMILES for 6-hydrazinyl-N-(1,3-thiazol-2-yl)pyridazine-3-carboxamide is NNc1ccc(C(=O)Nc2nccs2)nn1.
What is the InChIKey of 6-hydrazinyl-N-(1,3-thiazol-2-yl)pyridazine-3-carboxamide?
The InChIKey is HJHLWNXOFLPIBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N6OS/c9-12-6-2-1-5(13-14-6)7(15)11-8-10-3-4-16-8/h1-4H,9H2,(H,12,14)(H,10,11,15).
What are the key properties of 6-hydrazinyl-N-(1,3-thiazol-2-yl)pyridazine-3-carboxamide?
6-hydrazinyl-N-(1,3-thiazol-2-yl)pyridazine-3-carboxamide has a molecular weight of 236.26 g/mol, XLogP of 0.47, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydrazinyl-N-(1,3-thiazol-2-yl)pyridazine-3-carboxamide is sourced from PubChem (CID 62237920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).