C9H11N7OS — CID 107643252
N-(5-ethyl-1,3,4-thiadiazol-2-yl)-6-hydrazinylpyridazine-3-carboxamide (PubChem CID 107643252) has the molecular formula C9H11N7OS and a molecular weight of 265.30 g/mol. Its IUPAC name is N-(5-ethyl-1,3,4-thiadiazol-2-yl)-6-hydrazinylpyridazine-3-carboxamide.
| Compound Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-6-hydrazinylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 107643252 |
| Molecular Formula | C9H11N7OS |
| Molecular Weight | 265.30 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-6-hydrazinylpyridazine-3-carboxamide |
| SMILES | CCc1nnc(NC(=O)c2ccc(NN)nn2)s1 |
| InChI | InChI=1S/C9H11N7OS/c1-2-7-15-16-9(18-7)11-8(17)5-3-4-6(12-10)14-13-5/h3-4H,2,10H2,1H3,(H,12,14)(H,11,16,17) |
| InChIKey | JIMDKIZUJGUNMB-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 118.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.30 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|