C15H10Cl2O4 — CID 174558705
4-(2,4-dichlorophenyl)-2-methylbenzene-1,3-dicarboxylic acid (PubChem CID 174558705) has the molecular formula C15H10Cl2O4 and a molecular weight of 325.15 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-2-methylbenzene-1,3-dicarboxylic acid.
| Compound Name | 4-(2,4-dichlorophenyl)-2-methylbenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174558705 |
| Molecular Formula | C15H10Cl2O4 |
| Molecular Weight | 325.15 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-2-methylbenzene-1,3-dicarboxylic acid |
| SMILES | Cc1c(C(=O)O)ccc(-c2ccc(Cl)cc2Cl)c1C(=O)O |
| InChI | InChI=1S/C15H10Cl2O4/c1-7-9(14(18)19)4-5-11(13(7)15(20)21)10-3-2-8(16)6-12(10)17/h2-6H,1H3,(H,18,19)(H,20,21) |
| InChIKey | PHKSOOOOUSVNPQ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.15 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |