4-(2,4-dichlorophenyl)-2-methylbenzene-1,3-dicarboxylic acid

C15H10Cl2O4 — CID 174558705

IUPAC4-(2,4-dichlorophenyl)-2-methylbenzene-1,3-dicarboxylic acid
SMILESCc1c(C(=O)O)ccc(-c2ccc(Cl)cc2Cl)c1C(=O)O
InChIInChI=1S/C15H10Cl2O4/c1-7-9(14(18)19)4-5-11(13(7)15(20)21)10-3-2-8(16)6-12(10)17/h2-6H,1H3,(H,18,19)(H,20,21)
InChIKeyPHKSOOOOUSVNPQ-UHFFFAOYSA-N
MW325.15 g/mol
LogP4.37
Rot. Bonds3

About 4-(2,4-dichlorophenyl)-2-methylbenzene-1,3-dicarboxylic acid

4-(2,4-dichlorophenyl)-2-methylbenzene-1,3-dicarboxylic acid (PubChem CID 174558705) has the molecular formula C15H10Cl2O4 and a molecular weight of 325.15 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-2-methylbenzene-1,3-dicarboxylic acid.

Molecular Properties

Compound Name4-(2,4-dichlorophenyl)-2-methylbenzene-1,3-dicarboxylic acid
PubChem CID174558705
Molecular FormulaC15H10Cl2O4
Molecular Weight325.15 g/mol
Exact Mass324.00
IUPAC Name4-(2,4-dichlorophenyl)-2-methylbenzene-1,3-dicarboxylic acid
SMILESCc1c(C(=O)O)ccc(-c2ccc(Cl)cc2Cl)c1C(=O)O
InChIInChI=1S/C15H10Cl2O4/c1-7-9(14(18)19)4-5-11(13(7)15(20)21)10-3-2-8(16)6-12(10)17/h2-6H,1H3,(H,18,19)(H,20,21)
InChIKeyPHKSOOOOUSVNPQ-UHFFFAOYSA-N
XLogP4.37
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500325.15
LogP ≤ 54.37
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-(2,4-dichlorophenyl)-2-methylbenzene-1,3-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,4-dichlorophenyl)-2-methylbenzene-1,3-dicarboxylic acid?
The IUPAC name of 4-(2,4-dichlorophenyl)-2-methylbenzene-1,3-dicarboxylic acid (CID 174558705) is 4-(2,4-dichlorophenyl)-2-methylbenzene-1,3-dicarboxylic acid.
What is the SMILES notation for 4-(2,4-dichlorophenyl)-2-methylbenzene-1,3-dicarboxylic acid?
The canonical SMILES for 4-(2,4-dichlorophenyl)-2-methylbenzene-1,3-dicarboxylic acid is Cc1c(C(=O)O)ccc(-c2ccc(Cl)cc2Cl)c1C(=O)O.
What is the InChIKey of 4-(2,4-dichlorophenyl)-2-methylbenzene-1,3-dicarboxylic acid?
The InChIKey is PHKSOOOOUSVNPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10Cl2O4/c1-7-9(14(18)19)4-5-11(13(7)15(20)21)10-3-2-8(16)6-12(10)17/h2-6H,1H3,(H,18,19)(H,20,21).
What are the key properties of 4-(2,4-dichlorophenyl)-2-methylbenzene-1,3-dicarboxylic acid?
4-(2,4-dichlorophenyl)-2-methylbenzene-1,3-dicarboxylic acid has a molecular weight of 325.15 g/mol, XLogP of 4.37, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dichlorophenyl)-2-methylbenzene-1,3-dicarboxylic acid is sourced from PubChem (CID 174558705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).