About 2-acetyl-5-chlorobenzoic acid
2-acetyl-5-chlorobenzoic acid (PubChem CID 11229391) has the molecular formula C9H7ClO3
and a molecular weight of 198.60 g/mol. Its IUPAC name is 2-acetyl-5-chlorobenzoic acid.
Molecular Properties
| Compound Name | 2-acetyl-5-chlorobenzoic acid |
| PubChem CID | 11229391 |
| Molecular Formula | C9H7ClO3 |
| Molecular Weight | 198.60 g/mol |
| Exact Mass | 198.01 |
| IUPAC Name | 2-acetyl-5-chlorobenzoic acid |
| SMILES | CC(=O)c1ccc(Cl)cc1C(=O)O |
| InChI | InChI=1S/C9H7ClO3/c1-5(11)7-3-2-6(10)4-8(7)9(12)13/h2-4H,1H3,(H,12,13) |
| InChIKey | ABRNBYGTHSFKKS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.60 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-acetyl-5-chlorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyl-5-chlorobenzoic acid?
The IUPAC name of 2-acetyl-5-chlorobenzoic acid (CID 11229391) is 2-acetyl-5-chlorobenzoic acid.
What is the SMILES notation for 2-acetyl-5-chlorobenzoic acid?
The canonical SMILES for 2-acetyl-5-chlorobenzoic acid is CC(=O)c1ccc(Cl)cc1C(=O)O.
What is the InChIKey of 2-acetyl-5-chlorobenzoic acid?
The InChIKey is ABRNBYGTHSFKKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClO3/c1-5(11)7-3-2-6(10)4-8(7)9(12)13/h2-4H,1H3,(H,12,13).
What are the key properties of 2-acetyl-5-chlorobenzoic acid?
2-acetyl-5-chlorobenzoic acid has a molecular weight of 198.60 g/mol, XLogP of 2.24, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyl-5-chlorobenzoic acid is sourced from PubChem (CID 11229391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).