About 4-chloro-2-methylbenzoic acid;ethane
4-chloro-2-methylbenzoic acid;ethane (PubChem CID 145482472) has the molecular formula C10H13ClO2
and a molecular weight of 200.66 g/mol. Its IUPAC name is 4-chloro-2-methylbenzoic acid;ethane.
Molecular Properties
| Compound Name | 4-chloro-2-methylbenzoic acid;ethane |
| PubChem CID | 145482472 |
| Molecular Formula | C10H13ClO2 |
| Molecular Weight | 200.66 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 4-chloro-2-methylbenzoic acid;ethane |
| SMILES | CC.Cc1cc(Cl)ccc1C(=O)O |
| InChI | InChI=1S/C8H7ClO2.C2H6/c1-5-4-6(9)2-3-7(5)8(10)11;1-2/h2-4H,1H3,(H,10,11);1-2H3 |
| InChIKey | XTJHXHQGIMOPGH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.66 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-chloro-2-methylbenzoic acid;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-methylbenzoic acid;ethane?
The IUPAC name of 4-chloro-2-methylbenzoic acid;ethane (CID 145482472) is 4-chloro-2-methylbenzoic acid;ethane.
What is the SMILES notation for 4-chloro-2-methylbenzoic acid;ethane?
The canonical SMILES for 4-chloro-2-methylbenzoic acid;ethane is CC.Cc1cc(Cl)ccc1C(=O)O.
What is the InChIKey of 4-chloro-2-methylbenzoic acid;ethane?
The InChIKey is XTJHXHQGIMOPGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClO2.C2H6/c1-5-4-6(9)2-3-7(5)8(10)11;1-2/h2-4H,1H3,(H,10,11);1-2H3.
What are the key properties of 4-chloro-2-methylbenzoic acid;ethane?
4-chloro-2-methylbenzoic acid;ethane has a molecular weight of 200.66 g/mol, XLogP of 3.37, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-methylbenzoic acid;ethane is sourced from PubChem (CID 145482472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).