About 1-(4-chloro-2-methylphenyl)-2,2,2-trifluoroethanone
1-(4-chloro-2-methylphenyl)-2,2,2-trifluoroethanone (PubChem CID 2757718) has the molecular formula C9H6ClF3O
and a molecular weight of 222.59 g/mol. Its IUPAC name is 1-(4-chloro-2-methylphenyl)-2,2,2-trifluoroethanone.
Analyze 1-(4-chloro-2-methylphenyl)-2,2,2-trifluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chloro-2-methylphenyl)-2,2,2-trifluoroethanone?
The IUPAC name of 1-(4-chloro-2-methylphenyl)-2,2,2-trifluoroethanone (CID 2757718) is 1-(4-chloro-2-methylphenyl)-2,2,2-trifluoroethanone.
What is the SMILES notation for 1-(4-chloro-2-methylphenyl)-2,2,2-trifluoroethanone?
The canonical SMILES for 1-(4-chloro-2-methylphenyl)-2,2,2-trifluoroethanone is Cc1cc(Cl)ccc1C(=O)C(F)(F)F.
What is the InChIKey of 1-(4-chloro-2-methylphenyl)-2,2,2-trifluoroethanone?
The InChIKey is SJBSFYVEKYGCAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClF3O/c1-5-4-6(10)2-3-7(5)8(14)9(11,12)13/h2-4H,1H3.
What are the key properties of 1-(4-chloro-2-methylphenyl)-2,2,2-trifluoroethanone?
1-(4-chloro-2-methylphenyl)-2,2,2-trifluoroethanone has a molecular weight of 222.59 g/mol, XLogP of 3.39, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chloro-2-methylphenyl)-2,2,2-trifluoroethanone is sourced from PubChem (CID 2757718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).