C14H10Cl2F3NO — CID 100594570
1-[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2,2,2-trifluoroethanone (PubChem CID 100594570) has the molecular formula C14H10Cl2F3NO and a molecular weight of 336.14 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 100594570 |
| Molecular Formula | C14H10Cl2F3NO |
| Molecular Weight | 336.14 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2,2,2-trifluoroethanone |
| SMILES | Cc1cc(C(=O)C(F)(F)F)c(C)n1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H10Cl2F3NO/c1-7-5-10(13(21)14(17,18)19)8(2)20(7)12-4-3-9(15)6-11(12)16/h3-6H,1-2H3 |
| InChIKey | ZWAJMHNXBMZVCW-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.14 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|