C19H15Cl2NO2 — CID 69124480
1-[2-(2,5-dichlorophenyl)phenyl]-2,5-dimethylpyrrole-3-carboxylic acid (PubChem CID 69124480) has the molecular formula C19H15Cl2NO2 and a molecular weight of 360.24 g/mol. Its IUPAC name is 1-[2-(2,5-dichlorophenyl)phenyl]-2,5-dimethylpyrrole-3-carboxylic acid.
| Compound Name | 1-[2-(2,5-dichlorophenyl)phenyl]-2,5-dimethylpyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 69124480 |
| Molecular Formula | C19H15Cl2NO2 |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 1-[2-(2,5-dichlorophenyl)phenyl]-2,5-dimethylpyrrole-3-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)c(C)n1-c1ccccc1-c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C19H15Cl2NO2/c1-11-9-15(19(23)24)12(2)22(11)18-6-4-3-5-14(18)16-10-13(20)7-8-17(16)21/h3-10H,1-2H3,(H,23,24) |
| InChIKey | MBVALNHGMLJONO-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|