C20H19NO3 — CID 69123641
1-[2-(4-methoxyphenyl)phenyl]-2,5-dimethylpyrrole-3-carboxylic acid (PubChem CID 69123641) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenyl)phenyl]-2,5-dimethylpyrrole-3-carboxylic acid.
| Compound Name | 1-[2-(4-methoxyphenyl)phenyl]-2,5-dimethylpyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 69123641 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 1-[2-(4-methoxyphenyl)phenyl]-2,5-dimethylpyrrole-3-carboxylic acid |
| SMILES | COc1ccc(-c2ccccc2-n2c(C)cc(C(=O)O)c2C)cc1 |
| InChI | InChI=1S/C20H19NO3/c1-13-12-18(20(22)23)14(2)21(13)19-7-5-4-6-17(19)15-8-10-16(24-3)11-9-15/h4-12H,1-3H3,(H,22,23) |
| InChIKey | IJVQWHRLQIAAAL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|