C22H23NO2S — CID 69233702
1-[2-(3-ethyl-5-methylsulfanylphenyl)phenyl]-2,5-dimethylpyrrole-3-carboxylic acid (PubChem CID 69233702) has the molecular formula C22H23NO2S and a molecular weight of 365.50 g/mol. Its IUPAC name is 1-[2-(3-ethyl-5-methylsulfanylphenyl)phenyl]-2,5-dimethylpyrrole-3-carboxylic acid.
| Compound Name | 1-[2-(3-ethyl-5-methylsulfanylphenyl)phenyl]-2,5-dimethylpyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 69233702 |
| Molecular Formula | C22H23NO2S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 1-[2-(3-ethyl-5-methylsulfanylphenyl)phenyl]-2,5-dimethylpyrrole-3-carboxylic acid |
| SMILES | CCc1cc(SC)cc(-c2ccccc2-n2c(C)cc(C(=O)O)c2C)c1 |
| InChI | InChI=1S/C22H23NO2S/c1-5-16-11-17(13-18(12-16)26-4)19-8-6-7-9-21(19)23-14(2)10-20(15(23)3)22(24)25/h6-13H,5H2,1-4H3,(H,24,25) |
| InChIKey | KRDCSOUFNRGRIH-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|