C13H12INO2 — CID 28977736
1-(2-iodophenyl)-2,5-dimethylpyrrole-3-carboxylic acid (PubChem CID 28977736) has the molecular formula C13H12INO2 and a molecular weight of 341.15 g/mol. Its IUPAC name is 1-(2-iodophenyl)-2,5-dimethylpyrrole-3-carboxylic acid.
| Compound Name | 1-(2-iodophenyl)-2,5-dimethylpyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 28977736 |
| Molecular Formula | C13H12INO2 |
| Molecular Weight | 341.15 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | 1-(2-iodophenyl)-2,5-dimethylpyrrole-3-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)c(C)n1-c1ccccc1I |
| InChI | InChI=1S/C13H12INO2/c1-8-7-10(13(16)17)9(2)15(8)12-6-4-3-5-11(12)14/h3-7H,1-2H3,(H,16,17) |
| InChIKey | WGZVLPLDLIQHNB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.15 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|