C17H20N2O3 — CID 69124005
2,5-dimethyl-1-[2-(propan-2-ylcarbamoyl)phenyl]pyrrole-3-carboxylic acid (PubChem CID 69124005) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is 2,5-dimethyl-1-[2-(propan-2-ylcarbamoyl)phenyl]pyrrole-3-carboxylic acid.
| Compound Name | 2,5-dimethyl-1-[2-(propan-2-ylcarbamoyl)phenyl]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 69124005 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 2,5-dimethyl-1-[2-(propan-2-ylcarbamoyl)phenyl]pyrrole-3-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)c(C)n1-c1ccccc1C(=O)NC(C)C |
| InChI | InChI=1S/C17H20N2O3/c1-10(2)18-16(20)13-7-5-6-8-15(13)19-11(3)9-14(12(19)4)17(21)22/h5-10H,1-4H3,(H,18,20)(H,21,22) |
| InChIKey | WQWVODINEBCRKO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|