C18H22N2O3 — CID 119347913
3-[[2,5-dimethyl-1-(2-methylphenyl)pyrrole-3-carbonyl]amino]butanoic acid (PubChem CID 119347913) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is 3-[[2,5-dimethyl-1-(2-methylphenyl)pyrrole-3-carbonyl]amino]butanoic acid.
| Compound Name | 3-[[2,5-dimethyl-1-(2-methylphenyl)pyrrole-3-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119347913 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 3-[[2,5-dimethyl-1-(2-methylphenyl)pyrrole-3-carbonyl]amino]butanoic acid |
| SMILES | Cc1ccccc1-n1c(C)cc(C(=O)NC(C)CC(=O)O)c1C |
| InChI | InChI=1S/C18H22N2O3/c1-11-7-5-6-8-16(11)20-13(3)10-15(14(20)4)18(23)19-12(2)9-17(21)22/h5-8,10,12H,9H2,1-4H3,(H,19,23)(H,21,22) |
| InChIKey | UXIQYOFRYDEVHM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|