C20H24N2O3 — CID 120678201
cis-(1R,3S)-3-[[2,5-dimethyl-1-(2-methylphenyl)pyrrole-3-carbonyl]amino]cyclopentane-1-carboxylic acid (PubChem CID 120678201) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is cis-(1R,3S)-3-[[2,5-dimethyl-1-(2-methylphenyl)pyrrole-3-carbonyl]amino]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-3-[[2,5-dimethyl-1-(2-methylphenyl)pyrrole-3-carbonyl]amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 120678201 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | cis-(1R,3S)-3-[[2,5-dimethyl-1-(2-methylphenyl)pyrrole-3-carbonyl]amino]cyclopentane-1-carboxylic acid |
| SMILES | Cc1ccccc1-n1c(C)cc(C(=O)N[C@H]2CC[C@@H](C(=O)O)C2)c1C |
| InChI | InChI=1S/C20H24N2O3/c1-12-6-4-5-7-18(12)22-13(2)10-17(14(22)3)19(23)21-16-9-8-15(11-16)20(24)25/h4-7,10,15-16H,8-9,11H2,1-3H3,(H,21,23)(H,24,25)/t15-,16+/m1/s1 |
| InChIKey | QDMRCLQXPYYSHL-CVEARBPZSA-N |
| XLogP | 3.39 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|