2-(1,3-dioxoisoindol-2-yl)-4-(4-methoxyphenyl)benzoic acid

C22H15NO5 — CID 168518194

IUPAC2-(1,3-dioxoisoindol-2-yl)-4-(4-methoxyphenyl)benzoic acid
SMILESCOc1ccc(-c2ccc(C(=O)O)c(N3C(=O)c4ccccc4C3=O)c2)cc1
InChIInChI=1S/C22H15NO5/c1-28-15-9-6-13(7-10-15)14-8-11-18(22(26)27)19(12-14)23-20(24)16-4-2-3-5-17(16)21(23)25/h2-12H,1H3,(H,26,27)
InChIKeyKFRXONRBBBBLHC-UHFFFAOYSA-N
MW373.36 g/mol
LogP3.86
Rot. Bonds4

About 2-(1,3-dioxoisoindol-2-yl)-4-(4-methoxyphenyl)benzoic acid

2-(1,3-dioxoisoindol-2-yl)-4-(4-methoxyphenyl)benzoic acid (PubChem CID 168518194) has the molecular formula C22H15NO5 and a molecular weight of 373.36 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-4-(4-methoxyphenyl)benzoic acid.

Molecular Properties

Compound Name2-(1,3-dioxoisoindol-2-yl)-4-(4-methoxyphenyl)benzoic acid
PubChem CID168518194
Molecular FormulaC22H15NO5
Molecular Weight373.36 g/mol
Exact Mass373.10
IUPAC Name2-(1,3-dioxoisoindol-2-yl)-4-(4-methoxyphenyl)benzoic acid
SMILESCOc1ccc(-c2ccc(C(=O)O)c(N3C(=O)c4ccccc4C3=O)c2)cc1
InChIInChI=1S/C22H15NO5/c1-28-15-9-6-13(7-10-15)14-8-11-18(22(26)27)19(12-14)23-20(24)16-4-2-3-5-17(16)21(23)25/h2-12H,1H3,(H,26,27)
InChIKeyKFRXONRBBBBLHC-UHFFFAOYSA-N
XLogP3.86
TPSA83.91 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms28
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500373.36
LogP ≤ 53.86
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 2-(1,3-dioxoisoindol-2-yl)-4-(4-methoxyphenyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,3-dioxoisoindol-2-yl)-4-(4-methoxyphenyl)benzoic acid?
The IUPAC name of 2-(1,3-dioxoisoindol-2-yl)-4-(4-methoxyphenyl)benzoic acid (CID 168518194) is 2-(1,3-dioxoisoindol-2-yl)-4-(4-methoxyphenyl)benzoic acid.
What is the SMILES notation for 2-(1,3-dioxoisoindol-2-yl)-4-(4-methoxyphenyl)benzoic acid?
The canonical SMILES for 2-(1,3-dioxoisoindol-2-yl)-4-(4-methoxyphenyl)benzoic acid is COc1ccc(-c2ccc(C(=O)O)c(N3C(=O)c4ccccc4C3=O)c2)cc1.
What is the InChIKey of 2-(1,3-dioxoisoindol-2-yl)-4-(4-methoxyphenyl)benzoic acid?
The InChIKey is KFRXONRBBBBLHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15NO5/c1-28-15-9-6-13(7-10-15)14-8-11-18(22(26)27)19(12-14)23-20(24)16-4-2-3-5-17(16)21(23)25/h2-12H,1H3,(H,26,27).
What are the key properties of 2-(1,3-dioxoisoindol-2-yl)-4-(4-methoxyphenyl)benzoic acid?
2-(1,3-dioxoisoindol-2-yl)-4-(4-methoxyphenyl)benzoic acid has a molecular weight of 373.36 g/mol, XLogP of 3.86, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dioxoisoindol-2-yl)-4-(4-methoxyphenyl)benzoic acid is sourced from PubChem (CID 168518194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).