C22H15NO5 — CID 168518194
2-(1,3-dioxoisoindol-2-yl)-4-(4-methoxyphenyl)benzoic acid (PubChem CID 168518194) has the molecular formula C22H15NO5 and a molecular weight of 373.36 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-4-(4-methoxyphenyl)benzoic acid.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-4-(4-methoxyphenyl)benzoic acid |
|---|---|
| PubChem CID | 168518194 |
| Molecular Formula | C22H15NO5 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-4-(4-methoxyphenyl)benzoic acid |
| SMILES | COc1ccc(-c2ccc(C(=O)O)c(N3C(=O)c4ccccc4C3=O)c2)cc1 |
| InChI | InChI=1S/C22H15NO5/c1-28-15-9-6-13(7-10-15)14-8-11-18(22(26)27)19(12-14)23-20(24)16-4-2-3-5-17(16)21(23)25/h2-12H,1H3,(H,26,27) |
| InChIKey | KFRXONRBBBBLHC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|