C8H4ClF3O2 — CID 146015296
1-(4-chloro-2-hydroxyphenyl)-2,2,2-trifluoroethanone (PubChem CID 146015296) has the molecular formula C8H4ClF3O2 and a molecular weight of 224.56 g/mol. Its IUPAC name is 1-(4-chloro-2-hydroxyphenyl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(4-chloro-2-hydroxyphenyl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 146015296 |
| Molecular Formula | C8H4ClF3O2 |
| Molecular Weight | 224.56 g/mol |
| Exact Mass | 223.99 |
| IUPAC Name | 1-(4-chloro-2-hydroxyphenyl)-2,2,2-trifluoroethanone |
| SMILES | O=C(c1ccc(Cl)cc1O)C(F)(F)F |
| InChI | InChI=1S/C8H4ClF3O2/c9-4-1-2-5(6(13)3-4)7(14)8(10,11)12/h1-3,13H |
| InChIKey | ZOCOISZPDQVWOO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.56 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |