C8H6ClF3NOP — CID 58713618
1-[5-chloro-2-(phosphanylamino)phenyl]-2,2,2-trifluoroethanone (PubChem CID 58713618) has the molecular formula C8H6ClF3NOP and a molecular weight of 255.56 g/mol. Its IUPAC name is 1-[5-chloro-2-(phosphanylamino)phenyl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[5-chloro-2-(phosphanylamino)phenyl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 58713618 |
| Molecular Formula | C8H6ClF3NOP |
| Molecular Weight | 255.56 g/mol |
| Exact Mass | 254.98 |
| IUPAC Name | 1-[5-chloro-2-(phosphanylamino)phenyl]-2,2,2-trifluoroethanone |
| SMILES | O=C(c1cc(Cl)ccc1NP)C(F)(F)F |
| InChI | InChI=1S/C8H6ClF3NOP/c9-4-1-2-6(13-15)5(3-4)7(14)8(10,11)12/h1-3,13H,15H2 |
| InChIKey | LHMHWJWFHYVOED-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.56 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|