C11H11ClF3N3O — CID 106218313
5-chloro-2-hydrazinyl-N-[1-(trifluoromethyl)cyclopropyl]benzamide (PubChem CID 106218313) has the molecular formula C11H11ClF3N3O and a molecular weight of 293.68 g/mol. Its IUPAC name is 5-chloro-2-hydrazinyl-N-[1-(trifluoromethyl)cyclopropyl]benzamide.
| Compound Name | 5-chloro-2-hydrazinyl-N-[1-(trifluoromethyl)cyclopropyl]benzamide |
|---|---|
| PubChem CID | 106218313 |
| Molecular Formula | C11H11ClF3N3O |
| Molecular Weight | 293.68 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 5-chloro-2-hydrazinyl-N-[1-(trifluoromethyl)cyclopropyl]benzamide |
| SMILES | NNc1ccc(Cl)cc1C(=O)NC1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H11ClF3N3O/c12-6-1-2-8(18-16)7(5-6)9(19)17-10(3-4-10)11(13,14)15/h1-2,5,18H,3-4,16H2,(H,17,19) |
| InChIKey | JKTUVNLPQYWPNF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.68 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|