C13H10ClF3N2OS — CID 106215582
3-amino-6-chloro-N-[1-(trifluoromethyl)cyclopropyl]-1-benzothiophene-2-carboxamide (PubChem CID 106215582) has the molecular formula C13H10ClF3N2OS and a molecular weight of 334.75 g/mol. Its IUPAC name is 3-amino-6-chloro-N-[1-(trifluoromethyl)cyclopropyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-amino-6-chloro-N-[1-(trifluoromethyl)cyclopropyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 106215582 |
| Molecular Formula | C13H10ClF3N2OS |
| Molecular Weight | 334.75 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 3-amino-6-chloro-N-[1-(trifluoromethyl)cyclopropyl]-1-benzothiophene-2-carboxamide |
| SMILES | Nc1c(C(=O)NC2(C(F)(F)F)CC2)sc2cc(Cl)ccc12 |
| InChI | InChI=1S/C13H10ClF3N2OS/c14-6-1-2-7-8(5-6)21-10(9(7)18)11(20)19-12(3-4-12)13(15,16)17/h1-2,5H,3-4,18H2,(H,19,20) |
| InChIKey | LDABZXPKFOPPTJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.75 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |