C12H14F3N3O — CID 113486012
2-hydrazinyl-N-(1-methylcyclopropyl)-5-(trifluoromethyl)benzamide (PubChem CID 113486012) has the molecular formula C12H14F3N3O and a molecular weight of 273.26 g/mol. Its IUPAC name is 2-hydrazinyl-N-(1-methylcyclopropyl)-5-(trifluoromethyl)benzamide.
| Compound Name | 2-hydrazinyl-N-(1-methylcyclopropyl)-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 113486012 |
| Molecular Formula | C12H14F3N3O |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 2-hydrazinyl-N-(1-methylcyclopropyl)-5-(trifluoromethyl)benzamide |
| SMILES | CC1(NC(=O)c2cc(C(F)(F)F)ccc2NN)CC1 |
| InChI | InChI=1S/C12H14F3N3O/c1-11(4-5-11)17-10(19)8-6-7(12(13,14)15)2-3-9(8)18-16/h2-3,6,18H,4-5,16H2,1H3,(H,17,19) |
| InChIKey | QKSRFPOTVRPKDZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|