C17H20F4N2OS — CID 170190452
N-(4-fluoro-1-bicyclo[2.2.2]octanyl)-2-(methylsulfanylamino)-5-(trifluoromethyl)benzamide (PubChem CID 170190452) has the molecular formula C17H20F4N2OS and a molecular weight of 376.42 g/mol. Its IUPAC name is N-(4-fluoro-1-bicyclo[2.2.2]octanyl)-2-(methylsulfanylamino)-5-(trifluoromethyl)benzamide.
| Compound Name | N-(4-fluoro-1-bicyclo[2.2.2]octanyl)-2-(methylsulfanylamino)-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 170190452 |
| Molecular Formula | C17H20F4N2OS |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | N-(4-fluoro-1-bicyclo[2.2.2]octanyl)-2-(methylsulfanylamino)-5-(trifluoromethyl)benzamide |
| SMILES | CSNc1ccc(C(F)(F)F)cc1C(=O)NC12CCC(F)(CC1)CC2 |
| InChI | InChI=1S/C17H20F4N2OS/c1-25-23-13-3-2-11(17(19,20)21)10-12(13)14(24)22-16-7-4-15(18,5-8-16)6-9-16/h2-3,10,23H,4-9H2,1H3,(H,22,24) |
| InChIKey | VYOOARWMLNZUFC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|