C22H26F3N4O4S- — CID 175091670
1-[2-[(4-cyano-1-bicyclo[2.2.2]octanyl)carbamoyl]-N-sulfinato-4-(trifluoromethyl)anilino]-3-methoxy-3-methylazetidine (PubChem CID 175091670) has the molecular formula C22H26F3N4O4S- and a molecular weight of 499.54 g/mol. Its IUPAC name is 1-[2-[(4-cyano-1-bicyclo[2.2.2]octanyl)carbamoyl]-N-sulfinato-4-(trifluoromethyl)anilino]-3-methoxy-3-methylazetidine.
| Compound Name | 1-[2-[(4-cyano-1-bicyclo[2.2.2]octanyl)carbamoyl]-N-sulfinato-4-(trifluoromethyl)anilino]-3-methoxy-3-methylazetidine |
|---|---|
| PubChem CID | 175091670 |
| Molecular Formula | C22H26F3N4O4S- |
| Molecular Weight | 499.54 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | 1-[2-[(4-cyano-1-bicyclo[2.2.2]octanyl)carbamoyl]-N-sulfinato-4-(trifluoromethyl)anilino]-3-methoxy-3-methylazetidine |
| SMILES | COC1(C)CN(N(c2ccc(C(F)(F)F)cc2C(=O)NC23CCC(C#N)(CC2)CC3)S(=O)[O-])C1 |
| InChI | InChI=1S/C22H27F3N4O4S/c1-19(33-2)13-28(14-19)29(34(31)32)17-4-3-15(22(23,24)25)11-16(17)18(30)27-21-8-5-20(12-26,6-9-21)7-10-21/h3-4,11H,5-10,13-14H2,1-2H3,(H,27,30)(H,31,32)/p-1 |
| InChIKey | JQZRBIOBZOTNRY-UHFFFAOYSA-M |
| XLogP | 3.29 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.54 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|