C8H4ClF4NO — CID 18386558
1-(2-amino-5-chloro-3-fluorophenyl)-2,2,2-trifluoroethanone (PubChem CID 18386558) has the molecular formula C8H4ClF4NO and a molecular weight of 241.57 g/mol. Its IUPAC name is 1-(2-amino-5-chloro-3-fluorophenyl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(2-amino-5-chloro-3-fluorophenyl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 18386558 |
| Molecular Formula | C8H4ClF4NO |
| Molecular Weight | 241.57 g/mol |
| Exact Mass | 240.99 |
| IUPAC Name | 1-(2-amino-5-chloro-3-fluorophenyl)-2,2,2-trifluoroethanone |
| SMILES | Nc1c(F)cc(Cl)cc1C(=O)C(F)(F)F |
| InChI | InChI=1S/C8H4ClF4NO/c9-3-1-4(6(14)5(10)2-3)7(15)8(11,12)13/h1-2H,14H2 |
| InChIKey | FHUPUAABOQBCSO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.57 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|