C13H17ClFN3O2 — CID 126825227
(2-amino-5-chloro-3-fluorophenyl)-[3-(hydroxymethyl)-4-methylpiperazin-1-yl]methanone (PubChem CID 126825227) has the molecular formula C13H17ClFN3O2 and a molecular weight of 301.75 g/mol. Its IUPAC name is (2-amino-5-chloro-3-fluorophenyl)-[3-(hydroxymethyl)-4-methylpiperazin-1-yl]methanone.
| Compound Name | (2-amino-5-chloro-3-fluorophenyl)-[3-(hydroxymethyl)-4-methylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 126825227 |
| Molecular Formula | C13H17ClFN3O2 |
| Molecular Weight | 301.75 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | (2-amino-5-chloro-3-fluorophenyl)-[3-(hydroxymethyl)-4-methylpiperazin-1-yl]methanone |
| SMILES | CN1CCN(C(=O)c2cc(Cl)cc(F)c2N)CC1CO |
| InChI | InChI=1S/C13H17ClFN3O2/c1-17-2-3-18(6-9(17)7-19)13(20)10-4-8(14)5-11(15)12(10)16/h4-5,9,19H,2-3,6-7,16H2,1H3 |
| InChIKey | OCXYIQSHOUSSJV-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.75 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|