C14H20N2O3 — CID 77082052
[3-(hydroxymethyl)-4-methylpiperazin-1-yl]-[4-(hydroxymethyl)phenyl]methanone (PubChem CID 77082052) has the molecular formula C14H20N2O3 and a molecular weight of 264.33 g/mol. Its IUPAC name is [3-(hydroxymethyl)-4-methylpiperazin-1-yl]-[4-(hydroxymethyl)phenyl]methanone.
| Compound Name | [3-(hydroxymethyl)-4-methylpiperazin-1-yl]-[4-(hydroxymethyl)phenyl]methanone |
|---|---|
| PubChem CID | 77082052 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | [3-(hydroxymethyl)-4-methylpiperazin-1-yl]-[4-(hydroxymethyl)phenyl]methanone |
| SMILES | CN1CCN(C(=O)c2ccc(CO)cc2)CC1CO |
| InChI | InChI=1S/C14H20N2O3/c1-15-6-7-16(8-13(15)10-18)14(19)12-4-2-11(9-17)3-5-12/h2-5,13,17-18H,6-10H2,1H3 |
| InChIKey | TYONTKYUMYNNPR-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |