C12H12ClFN2O5S — CID 122126322
4-(2-amino-5-chloro-3-fluorobenzoyl)-1,1-dioxo-1,4-thiazinane-2-carboxylic acid (PubChem CID 122126322) has the molecular formula C12H12ClFN2O5S and a molecular weight of 350.76 g/mol. Its IUPAC name is 4-(2-amino-5-chloro-3-fluorobenzoyl)-1,1-dioxo-1,4-thiazinane-2-carboxylic acid.
| Compound Name | 4-(2-amino-5-chloro-3-fluorobenzoyl)-1,1-dioxo-1,4-thiazinane-2-carboxylic acid |
|---|---|
| PubChem CID | 122126322 |
| Molecular Formula | C12H12ClFN2O5S |
| Molecular Weight | 350.76 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | 4-(2-amino-5-chloro-3-fluorobenzoyl)-1,1-dioxo-1,4-thiazinane-2-carboxylic acid |
| SMILES | Nc1c(F)cc(Cl)cc1C(=O)N1CCS(=O)(=O)C(C(=O)O)C1 |
| InChI | InChI=1S/C12H12ClFN2O5S/c13-6-3-7(10(15)8(14)4-6)11(17)16-1-2-22(20,21)9(5-16)12(18)19/h3-4,9H,1-2,5,15H2,(H,18,19) |
| InChIKey | RENJXUDHOQVNSN-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.76 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|