C12H12FN3O7S — CID 122126307
4-(2-amino-5-fluoro-3-nitrobenzoyl)-1,1-dioxo-1,4-thiazinane-2-carboxylic acid (PubChem CID 122126307) has the molecular formula C12H12FN3O7S and a molecular weight of 361.31 g/mol. Its IUPAC name is 4-(2-amino-5-fluoro-3-nitrobenzoyl)-1,1-dioxo-1,4-thiazinane-2-carboxylic acid.
| Compound Name | 4-(2-amino-5-fluoro-3-nitrobenzoyl)-1,1-dioxo-1,4-thiazinane-2-carboxylic acid |
|---|---|
| PubChem CID | 122126307 |
| Molecular Formula | C12H12FN3O7S |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 4-(2-amino-5-fluoro-3-nitrobenzoyl)-1,1-dioxo-1,4-thiazinane-2-carboxylic acid |
| SMILES | Nc1c(C(=O)N2CCS(=O)(=O)C(C(=O)O)C2)cc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12FN3O7S/c13-6-3-7(10(14)8(4-6)16(20)21)11(17)15-1-2-24(22,23)9(5-15)12(18)19/h3-4,9H,1-2,5,14H2,(H,18,19) |
| InChIKey | JNVFGSXAMHYFLY-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 160.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|