C11H11Cl2FO — CID 146009509
1-(2,5-dichloro-3-fluorophenyl)-2,2-dimethylpropan-1-one (PubChem CID 146009509) has the molecular formula C11H11Cl2FO and a molecular weight of 249.11 g/mol. Its IUPAC name is 1-(2,5-dichloro-3-fluorophenyl)-2,2-dimethylpropan-1-one.
| Compound Name | 1-(2,5-dichloro-3-fluorophenyl)-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 146009509 |
| Molecular Formula | C11H11Cl2FO |
| Molecular Weight | 249.11 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | 1-(2,5-dichloro-3-fluorophenyl)-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)c1cc(Cl)cc(F)c1Cl |
| InChI | InChI=1S/C11H11Cl2FO/c1-11(2,3)10(15)7-4-6(12)5-8(14)9(7)13/h4-5H,1-3H3 |
| InChIKey | YITOBVBMLMBDGW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.11 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|