C11H9Cl2FO3 — CID 146009527
methyl 4-(2,5-dichloro-3-fluorophenyl)-4-oxobutanoate (PubChem CID 146009527) has the molecular formula C11H9Cl2FO3 and a molecular weight of 279.09 g/mol. Its IUPAC name is methyl 4-(2,5-dichloro-3-fluorophenyl)-4-oxobutanoate.
| Compound Name | methyl 4-(2,5-dichloro-3-fluorophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 146009527 |
| Molecular Formula | C11H9Cl2FO3 |
| Molecular Weight | 279.09 g/mol |
| Exact Mass | 277.99 |
| IUPAC Name | methyl 4-(2,5-dichloro-3-fluorophenyl)-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)c1cc(Cl)cc(F)c1Cl |
| InChI | InChI=1S/C11H9Cl2FO3/c1-17-10(16)3-2-9(15)7-4-6(12)5-8(14)11(7)13/h4-5H,2-3H2,1H3 |
| InChIKey | JMKYZPJTVLQHGX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.09 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|