C14H17ClO4 — CID 82550072
methyl 4-(5-chloro-2-propan-2-yloxyphenyl)-4-oxobutanoate (PubChem CID 82550072) has the molecular formula C14H17ClO4 and a molecular weight of 284.74 g/mol. Its IUPAC name is methyl 4-(5-chloro-2-propan-2-yloxyphenyl)-4-oxobutanoate.
| Compound Name | methyl 4-(5-chloro-2-propan-2-yloxyphenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 82550072 |
| Molecular Formula | C14H17ClO4 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | methyl 4-(5-chloro-2-propan-2-yloxyphenyl)-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)c1cc(Cl)ccc1OC(C)C |
| InChI | InChI=1S/C14H17ClO4/c1-9(2)19-13-6-4-10(15)8-11(13)12(16)5-7-14(17)18-3/h4,6,8-9H,5,7H2,1-3H3 |
| InChIKey | HZXZNFILAPLSEP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |