C10H2Cl2F8O — CID 146009518
1-(2,5-dichloro-3-fluorophenyl)-2,2,3,3,4,4,4-heptafluorobutan-1-one (PubChem CID 146009518) has the molecular formula C10H2Cl2F8O and a molecular weight of 361.02 g/mol. Its IUPAC name is 1-(2,5-dichloro-3-fluorophenyl)-2,2,3,3,4,4,4-heptafluorobutan-1-one.
| Compound Name | 1-(2,5-dichloro-3-fluorophenyl)-2,2,3,3,4,4,4-heptafluorobutan-1-one |
|---|---|
| PubChem CID | 146009518 |
| Molecular Formula | C10H2Cl2F8O |
| Molecular Weight | 361.02 g/mol |
| Exact Mass | 359.94 |
| IUPAC Name | 1-(2,5-dichloro-3-fluorophenyl)-2,2,3,3,4,4,4-heptafluorobutan-1-one |
| SMILES | O=C(c1cc(Cl)cc(F)c1Cl)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H2Cl2F8O/c11-3-1-4(6(12)5(13)2-3)7(21)8(14,15)9(16,17)10(18,19)20/h1-2H |
| InChIKey | UDUSZBWMHYJWGY-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.02 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|