C13H6ClF7OS — CID 146010797
1-(5-chloro-3-methyl-1-benzothiophen-2-yl)-2,2,3,3,4,4,4-heptafluorobutan-1-one (PubChem CID 146010797) has the molecular formula C13H6ClF7OS and a molecular weight of 378.70 g/mol. Its IUPAC name is 1-(5-chloro-3-methyl-1-benzothiophen-2-yl)-2,2,3,3,4,4,4-heptafluorobutan-1-one.
| Compound Name | 1-(5-chloro-3-methyl-1-benzothiophen-2-yl)-2,2,3,3,4,4,4-heptafluorobutan-1-one |
|---|---|
| PubChem CID | 146010797 |
| Molecular Formula | C13H6ClF7OS |
| Molecular Weight | 378.70 g/mol |
| Exact Mass | 377.97 |
| IUPAC Name | 1-(5-chloro-3-methyl-1-benzothiophen-2-yl)-2,2,3,3,4,4,4-heptafluorobutan-1-one |
| SMILES | Cc1c(C(=O)C(F)(F)C(F)(F)C(F)(F)F)sc2ccc(Cl)cc12 |
| InChI | InChI=1S/C13H6ClF7OS/c1-5-7-4-6(14)2-3-8(7)23-9(5)10(22)11(15,16)12(17,18)13(19,20)21/h2-4H,1H3 |
| InChIKey | FMACMPPVBKXJLL-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.70 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|