C17H13ClOS — CID 146010828
1-(5-chloro-3-methyl-1-benzothiophen-2-yl)-2-phenylethanone (PubChem CID 146010828) has the molecular formula C17H13ClOS and a molecular weight of 300.81 g/mol. Its IUPAC name is 1-(5-chloro-3-methyl-1-benzothiophen-2-yl)-2-phenylethanone.
| Compound Name | 1-(5-chloro-3-methyl-1-benzothiophen-2-yl)-2-phenylethanone |
|---|---|
| PubChem CID | 146010828 |
| Molecular Formula | C17H13ClOS |
| Molecular Weight | 300.81 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 1-(5-chloro-3-methyl-1-benzothiophen-2-yl)-2-phenylethanone |
| SMILES | Cc1c(C(=O)Cc2ccccc2)sc2ccc(Cl)cc12 |
| InChI | InChI=1S/C17H13ClOS/c1-11-14-10-13(18)7-8-16(14)20-17(11)15(19)9-12-5-3-2-4-6-12/h2-8,10H,9H2,1H3 |
| InChIKey | BVLSVFYLUQUPLP-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.81 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |