C14H13ClOS — CID 81157445
2-(4-chlorophenyl)-1-(3,5-dimethylthiophen-2-yl)ethanone (PubChem CID 81157445) has the molecular formula C14H13ClOS and a molecular weight of 264.78 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-(3,5-dimethylthiophen-2-yl)ethanone.
| Compound Name | 2-(4-chlorophenyl)-1-(3,5-dimethylthiophen-2-yl)ethanone |
|---|---|
| PubChem CID | 81157445 |
| Molecular Formula | C14H13ClOS |
| Molecular Weight | 264.78 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 2-(4-chlorophenyl)-1-(3,5-dimethylthiophen-2-yl)ethanone |
| SMILES | Cc1cc(C)c(C(=O)Cc2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C14H13ClOS/c1-9-7-10(2)17-14(9)13(16)8-11-3-5-12(15)6-4-11/h3-7H,8H2,1-2H3 |
| InChIKey | NDLNKONMJNNCMO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.78 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |